About 4H-pyrrolo[1,2-a]indole-6-carbonitrile
4H-pyrrolo[1,2-a]indole-6-carbonitrile (PubChem CID 102517311) has the molecular formula C12H8N2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 4H-pyrrolo[1,2-a]indole-6-carbonitrile.
Molecular Properties
| Compound Name | 4H-pyrrolo[1,2-a]indole-6-carbonitrile |
| PubChem CID | 102517311 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 4H-pyrrolo[1,2-a]indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)Cc1cccn1-2 |
| InChI | InChI=1S/C12H8N2/c13-8-9-3-4-12-10(6-9)7-11-2-1-5-14(11)12/h1-6H,7H2 |
| InChIKey | XVBYCJQSGBHURN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-pyrrolo[1,2-a]indole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrrolo[1,2-a]indole-6-carbonitrile?
The IUPAC name of 4H-pyrrolo[1,2-a]indole-6-carbonitrile (CID 102517311) is 4H-pyrrolo[1,2-a]indole-6-carbonitrile.
What is the SMILES notation for 4H-pyrrolo[1,2-a]indole-6-carbonitrile?
The canonical SMILES for 4H-pyrrolo[1,2-a]indole-6-carbonitrile is N#Cc1ccc2c(c1)Cc1cccn1-2.
What is the InChIKey of 4H-pyrrolo[1,2-a]indole-6-carbonitrile?
The InChIKey is XVBYCJQSGBHURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2/c13-8-9-3-4-12-10(6-9)7-11-2-1-5-14(11)12/h1-6H,7H2.
What are the key properties of 4H-pyrrolo[1,2-a]indole-6-carbonitrile?
4H-pyrrolo[1,2-a]indole-6-carbonitrile has a molecular weight of 180.21 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrrolo[1,2-a]indole-6-carbonitrile is sourced from PubChem (CID 102517311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).