C12H8N2 — CID 102517311
4H-pyrrolo[1,2-a]indole-6-carbonitrile (PubChem CID 102517311) has the molecular formula C12H8N2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 4H-pyrrolo[1,2-a]indole-6-carbonitrile.
| Compound Name | 4H-pyrrolo[1,2-a]indole-6-carbonitrile |
|---|---|
| PubChem CID | 102517311 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 4H-pyrrolo[1,2-a]indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)Cc1cccn1-2 |
| InChI | InChI=1S/C12H8N2/c13-8-9-3-4-12-10(6-9)7-11-2-1-5-14(11)12/h1-6H,7H2 |
| InChIKey | XVBYCJQSGBHURN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |