C18H19F3N6O3 — CID 10251740
(E)-N-[4-[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 10251740) has the molecular formula C18H19F3N6O3 and a molecular weight of 424.38 g/mol. Its IUPAC name is (E)-N-[4-[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | (E)-N-[4-[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 10251740 |
| Molecular Formula | C18H19F3N6O3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (E)-N-[4-[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]piperazin-1-yl]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | C[C@@]1(N2CCN(/N=C/c3ccc(C(F)(F)F)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C18H19F3N6O3/c1-17(12-24-11-15(27(28)29)23-16(24)30-17)25-6-8-26(9-7-25)22-10-13-2-4-14(5-3-13)18(19,20)21/h2-5,10-11H,6-9,12H2,1H3/b22-10+/t17-/m0/s1 |
| InChIKey | NTTYISLFBKCWJN-KQFRHJRUSA-N |
| XLogP | 2.57 |
| TPSA | 89.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|