C32H36N2O7 — CID 102517574
N-[2-[bis(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxyphenyl]-4-nitrobenzamide (PubChem CID 102517574) has the molecular formula C32H36N2O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is N-[2-[bis(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxyphenyl]-4-nitrobenzamide.
| Compound Name | N-[2-[bis(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxyphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 102517574 |
| Molecular Formula | C32H36N2O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | N-[2-[bis(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxyphenyl]-4-nitrobenzamide |
| SMILES | COc1cc(NC(=O)c2ccc([N+](=O)[O-])cc2)c(C(c2ccc(C(C)(C)C)o2)c2ccc(C(C)(C)C)o2)cc1OC |
| InChI | InChI=1S/C32H36N2O7/c1-31(2,3)27-15-13-23(40-27)29(24-14-16-28(41-24)32(4,5)6)21-17-25(38-7)26(39-8)18-22(21)33-30(35)19-9-11-20(12-10-19)34(36)37/h9-18,29H,1-8H3,(H,33,35) |
| InChIKey | XUCFMAMVPPQXLM-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|