C36H44O4Si2 — CID 102517622
26,28-dimethoxy-11,23-bis(trimethylsilyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol (PubChem CID 102517622) has the molecular formula C36H44O4Si2 and a molecular weight of 596.92 g/mol. Its IUPAC name is 26,28-dimethoxy-11,23-bis(trimethylsilyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol.
| Compound Name | 26,28-dimethoxy-11,23-bis(trimethylsilyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 102517622 |
| Molecular Formula | C36H44O4Si2 |
| Molecular Weight | 596.92 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | 26,28-dimethoxy-11,23-bis(trimethylsilyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol |
| SMILES | COc1c2cccc1Cc1cc([Si](C)(C)C)cc(c1O)Cc1cccc(c1OC)Cc1cc([Si](C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C36H44O4Si2/c1-39-35-23-11-9-12-24(35)16-28-20-32(42(6,7)8)22-30(34(28)38)18-26-14-10-13-25(36(26)40-2)17-29-21-31(41(3,4)5)19-27(15-23)33(29)37/h9-14,19-22,37-38H,15-18H2,1-8H3 |
| InChIKey | ABVINPRCFKPPLS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.92 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|