C15H18O — CID 102517946
(5S)-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene (PubChem CID 102517946) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (5S)-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene.
| Compound Name | (5S)-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 102517946 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (5S)-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene |
| SMILES | c1ccc([C@@H]2CCCC3=C2CCCO3)cc1 |
| InChI | InChI=1S/C15H18O/c1-2-6-12(7-3-1)13-8-4-10-15-14(13)9-5-11-16-15/h1-3,6-7,13H,4-5,8-11H2/t13-/m0/s1 |
| InChIKey | AXWDPHHLQQIBOK-ZDUSSCGKSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |