C16H20O — CID 102517948
(5S,6R)-6-methyl-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene (PubChem CID 102517948) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (5S,6R)-6-methyl-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene.
| Compound Name | (5S,6R)-6-methyl-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 102517948 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (5S,6R)-6-methyl-5-phenyl-3,4,5,6,7,8-hexahydro-2H-chromene |
| SMILES | C[C@@H]1CCC2=C(CCCO2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-12-9-10-15-14(8-5-11-17-15)16(12)13-6-3-2-4-7-13/h2-4,6-7,12,16H,5,8-11H2,1H3/t12-,16+/m1/s1 |
| InChIKey | XPRDLWDAUFCYGO-WBMJQRKESA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |