About (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol
(E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol (PubChem CID 102518103) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol |
| PubChem CID | 102518103 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol |
| SMILES | CCCCSc1ncc(/C(C)=C/CO)o1 |
| InChI | InChI=1S/C11H17NO2S/c1-3-4-7-15-11-12-8-10(14-11)9(2)5-6-13/h5,8,13H,3-4,6-7H2,1-2H3/b9-5+ |
| InChIKey | XJCWSRAPZLSMBZ-WEVVVXLNSA-N |
| XLogP | 2.96 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol?
The IUPAC name of (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol (CID 102518103) is (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol.
What is the SMILES notation for (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol?
The canonical SMILES for (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol is CCCCSc1ncc(/C(C)=C/CO)o1.
What is the InChIKey of (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol?
The InChIKey is XJCWSRAPZLSMBZ-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-3-4-7-15-11-12-8-10(14-11)9(2)5-6-13/h5,8,13H,3-4,6-7H2,1-2H3/b9-5+.
What are the key properties of (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol?
(E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol has a molecular weight of 227.33 g/mol, XLogP of 2.96, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2-butylsulfanyl-1,3-oxazol-5-yl)but-2-en-1-ol is sourced from PubChem (CID 102518103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).