C22H23F3O4 — CID 102518208
dimethyl (6R,7aS)-7,7-dimethyl-6-[4-(trifluoromethyl)phenyl]-6,7a-dihydro-1H-indene-2,2-dicarboxylate (PubChem CID 102518208) has the molecular formula C22H23F3O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is dimethyl (6R,7aS)-7,7-dimethyl-6-[4-(trifluoromethyl)phenyl]-6,7a-dihydro-1H-indene-2,2-dicarboxylate.
| Compound Name | dimethyl (6R,7aS)-7,7-dimethyl-6-[4-(trifluoromethyl)phenyl]-6,7a-dihydro-1H-indene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102518208 |
| Molecular Formula | C22H23F3O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | dimethyl (6R,7aS)-7,7-dimethyl-6-[4-(trifluoromethyl)phenyl]-6,7a-dihydro-1H-indene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C2C=C[C@@H](c3ccc(C(F)(F)F)cc3)C(C)(C)[C@@H]2C1 |
| InChI | InChI=1S/C22H23F3O4/c1-20(2)16(13-5-8-15(9-6-13)22(23,24)25)10-7-14-11-21(12-17(14)20,18(26)28-3)19(27)29-4/h5-11,16-17H,12H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | JAIAPTYIVACFQN-DLBZAZTESA-N |
| XLogP | 4.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|