C36H64O4Si2 — CID 102518308
tert-butyl-[(3Z,6R,7Z,9E,11Z,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dioxolan-2-yl)henicosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane (PubChem CID 102518308) has the molecular formula C36H64O4Si2 and a molecular weight of 617.08 g/mol. Its IUPAC name is tert-butyl-[(3Z,6R,7Z,9E,11Z,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dioxolan-2-yl)henicosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3Z,6R,7Z,9E,11Z,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dioxolan-2-yl)henicosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102518308 |
| Molecular Formula | C36H64O4Si2 |
| Molecular Weight | 617.08 g/mol |
| Exact Mass | 616.43 |
| IUPAC Name | tert-butyl-[(3Z,6R,7Z,9E,11Z,13S,15Z,18Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-dioxolan-2-yl)henicosa-3,7,9,11,15,18-hexaen-6-yl]oxy-dimethylsilane |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C\C=C\C=C/[C@@H](C/C=C\CCC1OCCO1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H64O4Si2/c1-12-13-14-15-16-20-25-32(39-41(8,9)35(2,3)4)26-21-17-18-22-27-33(40-42(10,11)36(5,6)7)28-23-19-24-29-34-37-30-31-38-34/h13-14,16-23,26-27,32-34H,12,15,24-25,28-31H2,1-11H3/b14-13-,18-17+,20-16-,23-19-,26-21-,27-22-/t32-,33-/m0/s1 |
| InChIKey | HRSNSOALFQBWJU-GGJLXSNMSA-N |
| XLogP | 10.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.08 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|