C26H35NO4 — CID 10251832
2-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 10251832) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 10251832 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 2-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | CCN(CCCCCC1Cc2cc(OC)c(OC)cc2C1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C26H35NO4/c1-5-27(18-20-12-8-9-13-23(20)29-2)14-10-6-7-11-19-15-21-16-24(30-3)25(31-4)17-22(21)26(19)28/h8-9,12-13,16-17,19H,5-7,10-11,14-15,18H2,1-4H3 |
| InChIKey | PNORNHQDZBPDRE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|