About N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide
N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide (PubChem CID 10251834) has the molecular formula C23H23NO3S2
and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide |
| PubChem CID | 10251834 |
| Molecular Formula | C23H23NO3S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc2c(c1)C(SCCNS(=O)(=O)c1ccccc1)c1ccccc1CO2 |
| InChI | InChI=1S/C23H23NO3S2/c1-17-11-12-22-21(15-17)23(20-10-6-5-7-18(20)16-27-22)28-14-13-24-29(25,26)19-8-3-2-4-9-19/h2-12,15,23-24H,13-14,16H2,1H3 |
| InChIKey | DJWBDUUGCJUQLF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide?
The IUPAC name of N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide (CID 10251834) is N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide.
What is the SMILES notation for N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide?
The canonical SMILES for N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide is Cc1ccc2c(c1)C(SCCNS(=O)(=O)c1ccccc1)c1ccccc1CO2.
What is the InChIKey of N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide?
The InChIKey is DJWBDUUGCJUQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO3S2/c1-17-11-12-22-21(15-17)23(20-10-6-5-7-18(20)16-27-22)28-14-13-24-29(25,26)19-8-3-2-4-9-19/h2-12,15,23-24H,13-14,16H2,1H3.
What are the key properties of N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide?
N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide has a molecular weight of 425.58 g/mol, XLogP of 4.69, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)sulfanyl]ethyl]benzenesulfonamide is sourced from PubChem (CID 10251834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).