C27H22O5 — CID 10251871
(4R,8S)-6,6-dimethyl-10-phenylmethoxy-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1,9,11,14,16,18-hexaene-13,20-dione (PubChem CID 10251871) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is (4R,8S)-6,6-dimethyl-10-phenylmethoxy-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1,9,11,14,16,18-hexaene-13,20-dione.
| Compound Name | (4R,8S)-6,6-dimethyl-10-phenylmethoxy-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1,9,11,14,16,18-hexaene-13,20-dione |
|---|---|
| PubChem CID | 10251871 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (4R,8S)-6,6-dimethyl-10-phenylmethoxy-5,7-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1,9,11,14,16,18-hexaene-13,20-dione |
| SMILES | CC1(C)O[C@@H]2Cc3c4c(cc(OCc5ccccc5)c3[C@@H]2O1)C(=O)c1ccccc1C4=O |
| InChI | InChI=1S/C27H22O5/c1-27(2)31-21-12-18-22-19(24(28)16-10-6-7-11-17(16)25(22)29)13-20(23(18)26(21)32-27)30-14-15-8-4-3-5-9-15/h3-11,13,21,26H,12,14H2,1-2H3/t21-,26-/m1/s1 |
| InChIKey | RBLDNTPPMWCVGA-QFQXNSOFSA-N |
| XLogP | 4.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|