C23H40O7Si — CID 102518714
(3'aS,5'S,6'R,6'aS,10'R,10'aS)-10'-[tert-butyl(dimethyl)silyl]oxy-5',6'-dihydroxy-2,2-dimethylspiro[1,3-dioxane-5,7'-3a,4,5,6,6a,8,9,10-octahydro-1H-benzo[d][2]benzofuran]-3'-one (PubChem CID 102518714) has the molecular formula C23H40O7Si and a molecular weight of 456.65 g/mol. Its IUPAC name is (3'aS,5'S,6'R,6'aS,10'R,10'aS)-10'-[tert-butyl(dimethyl)silyl]oxy-5',6'-dihydroxy-2,2-dimethylspiro[1,3-dioxane-5,7'-3a,4,5,6,6a,8,9,10-octahydro-1H-benzo[d][2]benzofuran]-3'-one.
| Compound Name | (3'aS,5'S,6'R,6'aS,10'R,10'aS)-10'-[tert-butyl(dimethyl)silyl]oxy-5',6'-dihydroxy-2,2-dimethylspiro[1,3-dioxane-5,7'-3a,4,5,6,6a,8,9,10-octahydro-1H-benzo[d][2]benzofuran]-3'-one |
|---|---|
| PubChem CID | 102518714 |
| Molecular Formula | C23H40O7Si |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (3'aS,5'S,6'R,6'aS,10'R,10'aS)-10'-[tert-butyl(dimethyl)silyl]oxy-5',6'-dihydroxy-2,2-dimethylspiro[1,3-dioxane-5,7'-3a,4,5,6,6a,8,9,10-octahydro-1H-benzo[d][2]benzofuran]-3'-one |
| SMILES | CC1(C)OCC2(CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]34COC(=O)[C@H]3C[C@H](O)[C@H](O)[C@@H]24)CO1 |
| InChI | InChI=1S/C23H40O7Si/c1-20(2,3)31(6,7)30-16-8-9-22(11-28-21(4,5)29-12-22)18-17(25)15(24)10-14-19(26)27-13-23(14,16)18/h14-18,24-25H,8-13H2,1-7H3/t14-,15+,16-,17+,18+,23+/m1/s1 |
| InChIKey | PQIJHCUALAROJB-XOFNMGDYSA-N |
| XLogP | 2.84 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|