C23H31NO2 — CID 102518743
(2S)-2-benzyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylhexanamide (PubChem CID 102518743) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (2S)-2-benzyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylhexanamide.
| Compound Name | (2S)-2-benzyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylhexanamide |
|---|---|
| PubChem CID | 102518743 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (2S)-2-benzyl-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylhexanamide |
| SMILES | CCCC[C@@H](Cc1ccccc1)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-4-5-14-21(17-19-12-8-6-9-13-19)23(26)24(3)18(2)22(25)20-15-10-7-11-16-20/h6-13,15-16,18,21-22,25H,4-5,14,17H2,1-3H3/t18-,21-,22+/m0/s1 |
| InChIKey | FVXPFBHOHGRUOW-YUXAGFNASA-N |
| XLogP | 4.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |