C17H17NO4 — CID 102518945
2-hydroxy-5-prop-2-enyl-1,2,3,4-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 102518945) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-hydroxy-5-prop-2-enyl-1,2,3,4-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | 2-hydroxy-5-prop-2-enyl-1,2,3,4-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 102518945 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-hydroxy-5-prop-2-enyl-1,2,3,4-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | C=CCn1c2c(c3cc4c(cc3c1=O)OCO4)CC(O)CC2 |
| InChI | InChI=1S/C17H17NO4/c1-2-5-18-14-4-3-10(19)6-12(14)11-7-15-16(22-9-21-15)8-13(11)17(18)20/h2,7-8,10,19H,1,3-6,9H2 |
| InChIKey | CIMRBMVYUOTHSF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|