About 25I-NBOMe
25I-NBOMe (PubChem CID 10251906) has the molecular formula C18H22INO3
and a molecular weight of 427.30 g/mol. Its IUPAC name is 2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine.
Molecular Properties
| Compound Name | 25I-NBOMe |
| PubChem CID | 10251906 |
| Molecular Formula | C18H22INO3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine |
| SMILES | COC1=CC=CC=C1CNCCC2=CC(=C(C=C2OC)I)OC |
| InChI | InChI=1S/C18H22INO3/c1-21-16-7-5-4-6-14(16)12-20-9-8-13-10-18(23-3)15(19)11-17(13)22-2/h4-7,10-11,20H,8-9,12H2,1-3H3 |
| InChIKey | ZFUOLNAKPBFDIJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | 331 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 25I-NBOMe with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 25I-NBOMe?
The IUPAC name of 25I-NBOMe (CID 10251906) is 2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine.
What is the SMILES notation for 25I-NBOMe?
The canonical SMILES for 25I-NBOMe is COC1=CC=CC=C1CNCCC2=CC(=C(C=C2OC)I)OC.
What is the InChIKey of 25I-NBOMe?
The InChIKey is ZFUOLNAKPBFDIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22INO3/c1-21-16-7-5-4-6-14(16)12-20-9-8-13-10-18(23-3)15(19)11-17(13)22-2/h4-7,10-11,20H,8-9,12H2,1-3H3.
What are the key properties of 25I-NBOMe?
25I-NBOMe has a molecular weight of 427.30 g/mol, XLogP of 3.80, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 25I-NBOMe is sourced from PubChem (CID 10251906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).