C18H22INO3 — CID 10251906
2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine (PubChem CID 10251906) has the molecular formula C18H22INO3 and a molecular weight of 427.28 g/mol. Its IUPAC name is 2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 10251906 |
| Molecular Formula | C18H22INO3 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-(4-iodo-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(CCNCc2ccccc2OC)c(OC)cc1I |
| InChI | InChI=1S/C18H22INO3/c1-21-16-7-5-4-6-14(16)12-20-9-8-13-10-18(23-3)15(19)11-17(13)22-2/h4-7,10-11,20H,8-9,12H2,1-3H3 |
| InChIKey | ZFUOLNAKPBFDIJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|