About tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate
tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate (PubChem CID 102519154) has the molecular formula C9H13F3O5S
and a molecular weight of 290.26 g/mol. Its IUPAC name is tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate.
Molecular Properties
| Compound Name | tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate |
| PubChem CID | 102519154 |
| Molecular Formula | C9H13F3O5S |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate |
| SMILES | C/C(=C/C(=O)OC(C)(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O5S/c1-6(5-7(13)16-8(2,3)4)17-18(14,15)9(10,11)12/h5H,1-4H3/b6-5- |
| InChIKey | JCMXKJYPUGFTAD-WAYWQWQTSA-N |
| XLogP | 2.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate?
The IUPAC name of tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate (CID 102519154) is tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate.
What is the SMILES notation for tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate?
The canonical SMILES for tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate is C/C(=C/C(=O)OC(C)(C)C)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate?
The InChIKey is JCMXKJYPUGFTAD-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H13F3O5S/c1-6(5-7(13)16-8(2,3)4)17-18(14,15)9(10,11)12/h5H,1-4H3/b6-5-.
What are the key properties of tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate?
tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate has a molecular weight of 290.26 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (Z)-3-(trifluoromethylsulfonyloxy)but-2-enoate is sourced from PubChem (CID 102519154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).