C38H40 — CID 102519254
6,7-bis(4-tert-butylphenyl)-15,16-dimethylidenetetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene (PubChem CID 102519254) has the molecular formula C38H40 and a molecular weight of 496.74 g/mol. Its IUPAC name is 6,7-bis(4-tert-butylphenyl)-15,16-dimethylidenetetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene.
| Compound Name | 6,7-bis(4-tert-butylphenyl)-15,16-dimethylidenetetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene |
|---|---|
| PubChem CID | 102519254 |
| Molecular Formula | C38H40 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 6,7-bis(4-tert-butylphenyl)-15,16-dimethylidenetetracyclo[10.2.2.02,11.04,9]hexadeca-2(11),4,6,8,13-pentaene |
| SMILES | C=C1C(=C)C2C=CC1C1=C2Cc2cc(-c3ccc(C(C)(C)C)cc3)c(-c3ccc(C(C)(C)C)cc3)cc2C1 |
| InChI | InChI=1S/C38H40/c1-23-24(2)32-18-17-31(23)35-21-27-19-33(25-9-13-29(14-10-25)37(3,4)5)34(20-28(27)22-36(32)35)26-11-15-30(16-12-26)38(6,7)8/h9-20,31-32H,1-2,21-22H2,3-8H3 |
| InChIKey | UWMORESVPWMRNT-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|