C15H26O3 — CID 102519762
(1S,2S,5R,6S,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-2,5-diol (PubChem CID 102519762) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,2S,5R,6S,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-2,5-diol.
| Compound Name | (1S,2S,5R,6S,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-2,5-diol |
|---|---|
| PubChem CID | 102519762 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2S,5R,6S,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-2,5-diol |
| SMILES | CC1(C)O[C@@]2(C)CC[C@@H]1C[C@H]1[C@](C)(O)CC[C@]12O |
| InChI | InChI=1S/C15H26O3/c1-12(2)10-5-6-14(4,18-12)15(17)8-7-13(3,16)11(15)9-10/h10-11,16-17H,5-9H2,1-4H3/t10-,11+,13-,14+,15+/m1/s1 |
| InChIKey | XNABOVWXFKMYBK-VEESAYDSSA-N |
| XLogP | 2.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |