C15H24O2 — CID 102519764
(1S,5R,6R,8S)-1,5,11,11-tetramethyltricyclo[6.2.1.02,6]undec-2-ene-5,8-diol (PubChem CID 102519764) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,5R,6R,8S)-1,5,11,11-tetramethyltricyclo[6.2.1.02,6]undec-2-ene-5,8-diol.
| Compound Name | (1S,5R,6R,8S)-1,5,11,11-tetramethyltricyclo[6.2.1.02,6]undec-2-ene-5,8-diol |
|---|---|
| PubChem CID | 102519764 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,5R,6R,8S)-1,5,11,11-tetramethyltricyclo[6.2.1.02,6]undec-2-ene-5,8-diol |
| SMILES | CC1(C)[C@]2(O)CC[C@@]1(C)C1=CC[C@@](C)(O)[C@@H]1C2 |
| InChI | InChI=1S/C15H24O2/c1-12(2)13(3)7-8-15(12,17)9-11-10(13)5-6-14(11,4)16/h5,11,16-17H,6-9H2,1-4H3/t11-,13+,14-,15+/m1/s1 |
| InChIKey | CACULIXBSFBBKT-BEAPCOKYSA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|