C25H36N2O4 — CID 10252000
8-[3-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]propyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 10252000) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 8-[3-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]propyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[3-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]propyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 10252000 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 8-[3-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]propyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | CCCN(CCCN1C(=O)CC2(CCCC2)CC1=O)C1COc2cccc(OC)c2C1 |
| InChI | InChI=1S/C25H36N2O4/c1-3-12-26(19-15-20-21(30-2)8-6-9-22(20)31-18-19)13-7-14-27-23(28)16-25(17-24(27)29)10-4-5-11-25/h6,8-9,19H,3-5,7,10-18H2,1-2H3 |
| InChIKey | AGKVXTQIBHAKGE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|