C28H47NO4S — CID 102520304
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-(2,2-dideuterioethenyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate (PubChem CID 102520304) has the molecular formula C28H47NO4S and a molecular weight of 495.77 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-(2,2-dideuterioethenyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-(2,2-dideuterioethenyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate |
|---|---|
| PubChem CID | 102520304 |
| Molecular Formula | C28H47NO4S |
| Molecular Weight | 495.77 g/mol |
| Exact Mass | 495.34 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-(2,2-dideuterioethenyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate |
| SMILES | [2H]C([2H])=C[C@]1(C)C[C@@H](OC(=O)CSCCN(CC)CC)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H47NO4S/c1-8-26(6)17-22(33-23(31)18-34-16-15-29(9-2)10-3)27(7)19(4)11-13-28(20(5)25(26)32)14-12-21(30)24(27)28/h8,19-20,22,24-25,32H,1,9-18H2,2-7H3/t19-,20+,22-,24+,25+,26-,27+,28+/m1/s1/i1D2 |
| InChIKey | UURAUHCOJAIIRQ-VUSSDMCMSA-N |
| XLogP | 4.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|