C16H19N3O6S — CID 102520409
(2S)-2-amino-4-oxo-4-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]butanoic acid (PubChem CID 102520409) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is (2S)-2-amino-4-oxo-4-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]butanoic acid.
| Compound Name | (2S)-2-amino-4-oxo-4-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]butanoic acid |
|---|---|
| PubChem CID | 102520409 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2S)-2-amino-4-oxo-4-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]butanoic acid |
| SMILES | N[C@@H](CC(=O)NCCNc1cccc2c(S(=O)(=O)O)cccc12)C(=O)O |
| InChI | InChI=1S/C16H19N3O6S/c17-12(16(21)22)9-15(20)19-8-7-18-13-5-1-4-11-10(13)3-2-6-14(11)26(23,24)25/h1-6,12,18H,7-9,17H2,(H,19,20)(H,21,22)(H,23,24,25)/t12-/m0/s1 |
| InChIKey | IQLIDZWGEYIYPJ-LBPRGKRZSA-N |
| XLogP | 0.42 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|