C20H23N5O4S — CID 10252045
N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]benzenesulfonamide (PubChem CID 10252045) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]benzenesulfonamide.
| Compound Name | N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10252045 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]benzenesulfonamide |
| SMILES | Cn1c(NS(=O)(=O)c2ccccc2)nc2c1c(=O)n(CC1CC1)c(=O)n2CC1CC1 |
| InChI | InChI=1S/C20H23N5O4S/c1-23-16-17(21-19(23)22-30(28,29)15-5-3-2-4-6-15)24(11-13-7-8-13)20(27)25(18(16)26)12-14-9-10-14/h2-6,13-14H,7-12H2,1H3,(H,21,22) |
| InChIKey | XGQMAYDPDYXFKL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |