About [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate
[4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate (PubChem CID 102520871) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate.
Molecular Properties
| Compound Name | [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate |
| PubChem CID | 102520871 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate |
| SMILES | COc1cc(CCCc2cc(C)c(OC#N)c(C)c2)ccc1OC#N |
| InChI | InChI=1S/C20H20N2O3/c1-14-9-17(10-15(2)20(14)25-13-22)6-4-5-16-7-8-18(24-12-21)19(11-16)23-3/h7-11H,4-6H2,1-3H3 |
| InChIKey | WDZHGQSDLLDVFI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate?
The IUPAC name of [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate (CID 102520871) is [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate.
What is the SMILES notation for [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate?
The canonical SMILES for [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate is COc1cc(CCCc2cc(C)c(OC#N)c(C)c2)ccc1OC#N.
What is the InChIKey of [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate?
The InChIKey is WDZHGQSDLLDVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3/c1-14-9-17(10-15(2)20(14)25-13-22)6-4-5-16-7-8-18(24-12-21)19(11-16)23-3/h7-11H,4-6H2,1-3H3.
What are the key properties of [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate?
[4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate has a molecular weight of 336.39 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(4-cyanato-3,5-dimethylphenyl)propyl]-2-methoxyphenyl] cyanate is sourced from PubChem (CID 102520871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).