C35H27BF2N2 — CID 102521446
2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-5,11-bis(2-phenylethynyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 102521446) has the molecular formula C35H27BF2N2 and a molecular weight of 524.42 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-5,11-bis(2-phenylethynyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-5,11-bis(2-phenylethynyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 102521446 |
| Molecular Formula | C35H27BF2N2 |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-phenyl-5,11-bis(2-phenylethynyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(C#Cc2ccccc2)C(C)=[N+]2C1=C(c1ccccc1)c1c(C)c(C#Cc3ccccc3)c(C)n1[B-]2(F)F |
| InChI | InChI=1S/C35H27BF2N2/c1-24-31(22-20-28-14-8-5-9-15-28)26(3)39-34(24)33(30-18-12-7-13-19-30)35-25(2)32(27(4)40(35)36(39,37)38)23-21-29-16-10-6-11-17-29/h5-19H,1-4H3 |
| InChIKey | KIUPYJFMGZBUMK-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|