About CID 102521820
CID 102521820 (PubChem CID 102521820) has the molecular formula C9H19IZn-
and a molecular weight of 319.55 g/mol.
Molecular Properties
| Compound Name | CID 102521820 |
| PubChem CID | 102521820 |
| Molecular Formula | C9H19IZn- |
| Molecular Weight | 319.55 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | — |
| SMILES | [CH2]CC(C)CC(C)(C)C.[I-].[Zn] |
| InChI | InChI=1S/C9H19.HI.Zn/c1-6-8(2)7-9(3,4)5;;/h8H,1,6-7H2,2-5H3;1H;/p-1 |
| InChIKey | QWKJGGRJEGRKSE-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.55 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 102521820 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102521820?
The IUPAC name of CID 102521820 (CID 102521820) is not available.
What is the SMILES notation for CID 102521820?
The canonical SMILES for CID 102521820 is [CH2]CC(C)CC(C)(C)C.[I-].[Zn].
What is the InChIKey of CID 102521820?
The InChIKey is QWKJGGRJEGRKSE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H19.HI.Zn/c1-6-8(2)7-9(3,4)5;;/h8H,1,6-7H2,2-5H3;1H;/p-1.
What are the key properties of CID 102521820?
CID 102521820 has a molecular weight of 319.55 g/mol, XLogP of 0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102521820 is sourced from PubChem (CID 102521820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).