C17H20O6 — CID 102522735
[(3R,4S)-3-acetyloxy-5-methyl-2,3,4,7-tetrahydrooxepin-4-yl] 4-methoxybenzoate (PubChem CID 102522735) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3R,4S)-3-acetyloxy-5-methyl-2,3,4,7-tetrahydrooxepin-4-yl] 4-methoxybenzoate.
| Compound Name | [(3R,4S)-3-acetyloxy-5-methyl-2,3,4,7-tetrahydrooxepin-4-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 102522735 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(3R,4S)-3-acetyloxy-5-methyl-2,3,4,7-tetrahydrooxepin-4-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2C(C)=CCOC[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C17H20O6/c1-11-8-9-21-10-15(22-12(2)18)16(11)23-17(19)13-4-6-14(20-3)7-5-13/h4-8,15-16H,9-10H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | KILLBTGRSYVTIS-CVEARBPZSA-N |
| XLogP | 2.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|