C17H26N2O2Si — CID 102522757
tert-butyl-dimethyl-[[(1S,4R)-3-pyridin-2-yl-2-oxa-3-azabicyclo[2.2.2]oct-5-en-5-yl]oxy]silane (PubChem CID 102522757) has the molecular formula C17H26N2O2Si and a molecular weight of 318.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,4R)-3-pyridin-2-yl-2-oxa-3-azabicyclo[2.2.2]oct-5-en-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,4R)-3-pyridin-2-yl-2-oxa-3-azabicyclo[2.2.2]oct-5-en-5-yl]oxy]silane |
|---|---|
| PubChem CID | 102522757 |
| Molecular Formula | C17H26N2O2Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,4R)-3-pyridin-2-yl-2-oxa-3-azabicyclo[2.2.2]oct-5-en-5-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@@H]2CC[C@H]1N(c1ccccn1)O2 |
| InChI | InChI=1S/C17H26N2O2Si/c1-17(2,3)22(4,5)21-15-12-13-9-10-14(15)19(20-13)16-8-6-7-11-18-16/h6-8,11-14H,9-10H2,1-5H3/t13-,14+/m0/s1 |
| InChIKey | VBFDBCZPQKPBEE-UONOGXRCSA-N |
| XLogP | 4.27 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|