C38H72O6Si2 — CID 102522913
(E,4R,8S,9S)-4-hydroxy-1-[(2S,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-7,9-dimethyl-8-tri(propan-2-yl)silyloxyundec-6-en-10-yn-2-one (PubChem CID 102522913) has the molecular formula C38H72O6Si2 and a molecular weight of 681.16 g/mol. Its IUPAC name is (E,4R,8S,9S)-4-hydroxy-1-[(2S,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-7,9-dimethyl-8-tri(propan-2-yl)silyloxyundec-6-en-10-yn-2-one.
| Compound Name | (E,4R,8S,9S)-4-hydroxy-1-[(2S,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-7,9-dimethyl-8-tri(propan-2-yl)silyloxyundec-6-en-10-yn-2-one |
|---|---|
| PubChem CID | 102522913 |
| Molecular Formula | C38H72O6Si2 |
| Molecular Weight | 681.16 g/mol |
| Exact Mass | 680.49 |
| IUPAC Name | (E,4R,8S,9S)-4-hydroxy-1-[(2S,4S,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-7,9-dimethyl-8-tri(propan-2-yl)silyloxyundec-6-en-10-yn-2-one |
| SMILES | C#C[C@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)/C(C)=C/C[C@@H](O)CC(=O)C[C@]1(OC)C[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C38H72O6Si2/c1-17-30(13)37(44-46(27(7)8,28(9)10)29(11)12)31(14)21-22-33(39)23-34(40)24-38(41-16)25-35(32(15)36(42-38)26(5)6)43-45(18-2,19-3)20-4/h1,21,26-30,32-33,35-37,39H,18-20,22-25H2,2-16H3/b31-21+/t30-,32-,33+,35-,36+,37-,38+/m0/s1 |
| InChIKey | JKXBZRMFPRCHPM-GRNDEVHCSA-N |
| XLogP | 9.68 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.16 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|