C23H26F3N3O2 — CID 10252297
(2S,5R)-5-prop-1-ynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 10252297) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is (2S,5R)-5-prop-1-ynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S,5R)-5-prop-1-ynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 10252297 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (2S,5R)-5-prop-1-ynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | CC#C[C@H]1CC[C@@H](C#N)N1C(=O)CNC1CCC(Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H26F3N3O2/c1-2-3-18-8-9-19(14-27)29(18)22(30)15-28-17-6-12-21(13-7-17)31-20-10-4-16(5-11-20)23(24,25)26/h4-5,10-11,17-19,21,28H,6-9,12-13,15H2,1H3/t17?,18-,19-,21?/m0/s1 |
| InChIKey | ARQRELUDHZKQQO-JMDAGXMHSA-N |
| XLogP | 3.89 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|