C23H23N5O2S — CID 10252312
6-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-N-ethylquinazoline-2,4,6-triamine (PubChem CID 10252312) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 6-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-N-ethylquinazoline-2,4,6-triamine.
| Compound Name | 6-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-N-ethylquinazoline-2,4,6-triamine |
|---|---|
| PubChem CID | 10252312 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 6-N-[[4-(benzenesulfonyl)phenyl]methyl]-6-N-ethylquinazoline-2,4,6-triamine |
| SMILES | CCN(Cc1ccc(S(=O)(=O)c2ccccc2)cc1)c1ccc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C23H23N5O2S/c1-2-28(17-10-13-21-20(14-17)22(24)27-23(25)26-21)15-16-8-11-19(12-9-16)31(29,30)18-6-4-3-5-7-18/h3-14H,2,15H2,1H3,(H4,24,25,26,27) |
| InChIKey | HSTQUJPVNIIZRC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |