C25H27N2OP — CID 102523352
(2S)-2-[bis(2-methylphenyl)phosphorylamino]-2-phenylpentanenitrile (PubChem CID 102523352) has the molecular formula C25H27N2OP and a molecular weight of 402.48 g/mol. Its IUPAC name is (2S)-2-[bis(2-methylphenyl)phosphorylamino]-2-phenylpentanenitrile.
| Compound Name | (2S)-2-[bis(2-methylphenyl)phosphorylamino]-2-phenylpentanenitrile |
|---|---|
| PubChem CID | 102523352 |
| Molecular Formula | C25H27N2OP |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (2S)-2-[bis(2-methylphenyl)phosphorylamino]-2-phenylpentanenitrile |
| SMILES | CCC[C@](C#N)(NP(=O)(c1ccccc1C)c1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C25H27N2OP/c1-4-18-25(19-26,22-14-6-5-7-15-22)27-29(28,23-16-10-8-12-20(23)2)24-17-11-9-13-21(24)3/h5-17H,4,18H2,1-3H3,(H,27,28)/t25-/m1/s1 |
| InChIKey | BIKXCJPVTXFGAV-RUZDIDTESA-N |
| XLogP | 5.34 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|