C21H26FN3O2S2 — CID 10252435
trans-(1S,2R)-2-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 10252435) has the molecular formula C21H26FN3O2S2 and a molecular weight of 435.59 g/mol. Its IUPAC name is trans-(1S,2R)-2-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | trans-(1S,2R)-2-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 10252435 |
| Molecular Formula | C21H26FN3O2S2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | trans-(1S,2R)-2-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)[C@@]1(c2cccnc2)CCCC[C@@H]1CCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN3O2S2/c1-23-20(28)21(17-6-4-13-24-15-17)12-3-2-5-16(21)11-14-25-29(26,27)19-9-7-18(22)8-10-19/h4,6-10,13,15-16,25H,2-3,5,11-12,14H2,1H3,(H,23,28)/t16-,21+/m1/s1 |
| InChIKey | JOTJZHLPBJPGBV-IERDGZPVSA-N |
| XLogP | 3.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|