About 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane
2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane (PubChem CID 102524572) has the molecular formula C10H15IO2
and a molecular weight of 294.13 g/mol. Its IUPAC name is 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane.
Molecular Properties
| Compound Name | 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane |
| PubChem CID | 102524572 |
| Molecular Formula | C10H15IO2 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane |
| SMILES | CC(/C=C\I)/C=C/OC1CCCO1 |
| InChI | InChI=1S/C10H15IO2/c1-9(4-6-11)5-8-13-10-3-2-7-12-10/h4-6,8-10H,2-3,7H2,1H3/b6-4-,8-5+ |
| InChIKey | IFCDUTFTEIWZOW-QXMOYCCXSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane?
The IUPAC name of 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane (CID 102524572) is 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane.
What is the SMILES notation for 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane?
The canonical SMILES for 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane is CC(/C=C\I)/C=C/OC1CCCO1.
What is the InChIKey of 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane?
The InChIKey is IFCDUTFTEIWZOW-QXMOYCCXSA-N. The full InChI is InChI=1S/C10H15IO2/c1-9(4-6-11)5-8-13-10-3-2-7-12-10/h4-6,8-10H,2-3,7H2,1H3/b6-4-,8-5+.
What are the key properties of 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane?
2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane has a molecular weight of 294.13 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E,4Z)-5-iodo-3-methylpenta-1,4-dienoxy]oxolane is sourced from PubChem (CID 102524572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).