C8H7F3NO2- — CID 102524597
(Z)-1-(4,5-dimethyl-1,3-oxazol-2-yl)-3,3,3-trifluoroprop-1-en-2-olate (PubChem CID 102524597) has the molecular formula C8H7F3NO2- and a molecular weight of 206.14 g/mol. Its IUPAC name is (Z)-1-(4,5-dimethyl-1,3-oxazol-2-yl)-3,3,3-trifluoroprop-1-en-2-olate.
| Compound Name | (Z)-1-(4,5-dimethyl-1,3-oxazol-2-yl)-3,3,3-trifluoroprop-1-en-2-olate |
|---|---|
| PubChem CID | 102524597 |
| Molecular Formula | C8H7F3NO2- |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | (Z)-1-(4,5-dimethyl-1,3-oxazol-2-yl)-3,3,3-trifluoroprop-1-en-2-olate |
| SMILES | Cc1nc(/C=C(\[O-])C(F)(F)F)oc1C |
| InChI | InChI=1S/C8H8F3NO2/c1-4-5(2)14-7(12-4)3-6(13)8(9,10)11/h3,13H,1-2H3/p-1/b6-3- |
| InChIKey | UQDZTCKASNUQGX-UTCJRWHESA-M |
| XLogP | 1.55 |
| TPSA | 49.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|