C32H43N3O2S3 — CID 102525010
(E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102525010) has the molecular formula C32H43N3O2S3 and a molecular weight of 597.92 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102525010 |
| Molecular Formula | C32H43N3O2S3 |
| Molecular Weight | 597.92 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCCc1csc(-c2nc(CCCCCCCCC)c(-c3ccc(/C=C(\C#N)C(=O)O)s3)s2)n1 |
| InChI | InChI=1S/C32H43N3O2S3/c1-3-5-7-9-11-13-15-17-25-23-38-30(34-25)31-35-27(18-16-14-12-10-8-6-4-2)29(40-31)28-20-19-26(39-28)21-24(22-33)32(36)37/h19-21,23H,3-18H2,1-2H3,(H,36,37)/b24-21+ |
| InChIKey | ZWUIBUPFALGFPB-DARPEHSRSA-N |
| XLogP | 10.57 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.92 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|