C30H25NO6S2 — CID 102525071
2-[3,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)carbazol-9-yl]ethyl 2-methylprop-2-enoate (PubChem CID 102525071) has the molecular formula C30H25NO6S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-[3,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)carbazol-9-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)carbazol-9-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102525071 |
| Molecular Formula | C30H25NO6S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 2-[3,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)carbazol-9-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCn1c2ccc(-c3scc4c3OCCO4)cc2c2cc(-c3scc4c3OCCO4)ccc21 |
| InChI | InChI=1S/C30H25NO6S2/c1-17(2)30(32)37-8-7-31-22-5-3-18(28-26-24(15-38-28)33-9-11-35-26)13-20(22)21-14-19(4-6-23(21)31)29-27-25(16-39-29)34-10-12-36-27/h3-6,13-16H,1,7-12H2,2H3 |
| InChIKey | FMDMDQBOQZFHQX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 68.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|