C24H31N5O3 — CID 10252547
14-[2-(diethylamino)ethyl]-4-hydroxy-10-[2-(2-hydroxyethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one (PubChem CID 10252547) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 14-[2-(diethylamino)ethyl]-4-hydroxy-10-[2-(2-hydroxyethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one.
| Compound Name | 14-[2-(diethylamino)ethyl]-4-hydroxy-10-[2-(2-hydroxyethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one |
|---|---|
| PubChem CID | 10252547 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 14-[2-(diethylamino)ethyl]-4-hydroxy-10-[2-(2-hydroxyethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one |
| SMILES | CCN(CC)CCn1nc2c3c(c(NCCNCCO)ccc31)C(=O)c1ccc(O)cc1-2 |
| InChI | InChI=1S/C24H31N5O3/c1-3-28(4-2)12-13-29-20-8-7-19(26-10-9-25-11-14-30)21-22(20)23(27-29)18-15-16(31)5-6-17(18)24(21)32/h5-8,15,25-26,30-31H,3-4,9-14H2,1-2H3 |
| InChIKey | VBONXXLEKGMKIJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|