C11H12F14N2 — CID 10252560
3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)decane-1,10-diamine (PubChem CID 10252560) has the molecular formula C11H12F14N2 and a molecular weight of 438.20 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)decane-1,10-diamine.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)decane-1,10-diamine |
|---|---|
| PubChem CID | 10252560 |
| Molecular Formula | C11H12F14N2 |
| Molecular Weight | 438.20 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)decane-1,10-diamine |
| SMILES | NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(CCN)C(F)(F)F |
| InChI | InChI=1S/C11H12F14N2/c12-5(1-3-26,11(23,24)25)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)2-4-27/h1-4,26-27H2 |
| InChIKey | VCLATTSWRJFEBB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|