C15H20BrNO7S — CID 10252562
[(4R,6R,7S)-4-bromo-2-(2,2-dimethylpropanoyl)-7-methoxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate (PubChem CID 10252562) has the molecular formula C15H20BrNO7S and a molecular weight of 438.30 g/mol. Its IUPAC name is [(4R,6R,7S)-4-bromo-2-(2,2-dimethylpropanoyl)-7-methoxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate.
| Compound Name | [(4R,6R,7S)-4-bromo-2-(2,2-dimethylpropanoyl)-7-methoxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10252562 |
| Molecular Formula | C15H20BrNO7S |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | [(4R,6R,7S)-4-bromo-2-(2,2-dimethylpropanoyl)-7-methoxy-5,5,8-trioxo-5lambda6-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate |
| SMILES | CO[C@H]1C(=O)N2C(C(=O)C(C)(C)C)=C(COC(C)=O)[C@@H](Br)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C15H20BrNO7S/c1-7(18)24-6-8-9(11(19)15(2,3)4)17-13(20)10(23-5)14(17)25(21,22)12(8)16/h10,12,14H,6H2,1-5H3/t10-,12-,14+/m0/s1 |
| InChIKey | RRQIYCAEFUMSQI-VHRBIJSZSA-N |
| XLogP | 0.75 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|