C16H24N4Si2 — CID 102525651
3-[[4,5-bis(trimethylsilyl)triazol-1-yl]methyl]benzonitrile (PubChem CID 102525651) has the molecular formula C16H24N4Si2 and a molecular weight of 328.57 g/mol. Its IUPAC name is 3-[[4,5-bis(trimethylsilyl)triazol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4,5-bis(trimethylsilyl)triazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 102525651 |
| Molecular Formula | C16H24N4Si2 |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-[[4,5-bis(trimethylsilyl)triazol-1-yl]methyl]benzonitrile |
| SMILES | C[Si](C)(C)c1nnn(Cc2cccc(C#N)c2)c1[Si](C)(C)C |
| InChI | InChI=1S/C16H24N4Si2/c1-21(2,3)15-16(22(4,5)6)20(19-18-15)12-14-9-7-8-13(10-14)11-17/h7-10H,12H2,1-6H3 |
| InChIKey | ZJYYCVBXTNIACE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|