About cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate
cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate (PubChem CID 102525678) has the molecular formula C17H25O6PS
and a molecular weight of 388.42 g/mol. Its IUPAC name is cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate |
| PubChem CID | 102525678 |
| Molecular Formula | C17H25O6PS |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate |
| SMILES | COP(=O)(OC)[C@@]1(C(=O)OC(C)(C)C)C[C@@H]1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25O6PS/c1-12-7-9-13(10-8-12)25(20)14-11-17(14,24(19,21-5)22-6)15(18)23-16(2,3)4/h7-10,14H,11H2,1-6H3/t14-,17-,25?/m0/s1 |
| InChIKey | DJDWHCQRSXQVJX-VCUATYFUSA-N |
| XLogP | 3.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate?
The IUPAC name of cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate (CID 102525678) is cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate.
What is the SMILES notation for cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate?
The canonical SMILES for cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate is COP(=O)(OC)[C@@]1(C(=O)OC(C)(C)C)C[C@@H]1S(=O)c1ccc(C)cc1.
What is the InChIKey of cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate?
The InChIKey is DJDWHCQRSXQVJX-VCUATYFUSA-N. The full InChI is InChI=1S/C17H25O6PS/c1-12-7-9-13(10-8-12)25(20)14-11-17(14,24(19,21-5)22-6)15(18)23-16(2,3)4/h7-10,14H,11H2,1-6H3/t14-,17-,25?/m0/s1.
What are the key properties of cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate?
cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate has a molecular weight of 388.42 g/mol, XLogP of 3.44, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cis-tert-butyl (1R,2S)-1-dimethoxyphosphoryl-2-(4-methylphenyl)sulfinylcyclopropane-1-carboxylate is sourced from PubChem (CID 102525678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).