C30H31ClN2O2 — CID 102525873
(4R,4aS,8aR)-4-[(4-chloroanilino)-(4-methoxyphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one (PubChem CID 102525873) has the molecular formula C30H31ClN2O2 and a molecular weight of 487.04 g/mol. Its IUPAC name is (4R,4aS,8aR)-4-[(4-chloroanilino)-(4-methoxyphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one.
| Compound Name | (4R,4aS,8aR)-4-[(4-chloroanilino)-(4-methoxyphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one |
|---|---|
| PubChem CID | 102525873 |
| Molecular Formula | C30H31ClN2O2 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (4R,4aS,8aR)-4-[(4-chloroanilino)-(4-methoxyphenyl)methyl]-2-(4-methylphenyl)-1,4,4a,7,8,8a-hexahydroisoquinolin-3-one |
| SMILES | COc1ccc(C(Nc2ccc(Cl)cc2)[C@@H]2C(=O)N(c3ccc(C)cc3)C[C@@H]3CCC=C[C@@H]32)cc1 |
| InChI | InChI=1S/C30H31ClN2O2/c1-20-7-15-25(16-8-20)33-19-22-5-3-4-6-27(22)28(30(33)34)29(21-9-17-26(35-2)18-10-21)32-24-13-11-23(31)12-14-24/h4,6-18,22,27-29,32H,3,5,19H2,1-2H3/t22-,27-,28+,29?/m0/s1 |
| InChIKey | LRLWCWZYZLWFFQ-MPOWVJJTSA-N |
| XLogP | 7.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|