C26H27N5S — CID 102525960
N,N-bis(1H-benzimidazol-2-ylmethyl)-2-(2,4-dimethylphenyl)sulfanylethanamine (PubChem CID 102525960) has the molecular formula C26H27N5S and a molecular weight of 441.60 g/mol. Its IUPAC name is N,N-bis(1H-benzimidazol-2-ylmethyl)-2-(2,4-dimethylphenyl)sulfanylethanamine.
| Compound Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-2-(2,4-dimethylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 102525960 |
| Molecular Formula | C26H27N5S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-2-(2,4-dimethylphenyl)sulfanylethanamine |
| SMILES | Cc1ccc(SCCN(Cc2nc3ccccc3[nH]2)Cc2nc3ccccc3[nH]2)c(C)c1 |
| InChI | InChI=1S/C26H27N5S/c1-18-11-12-24(19(2)15-18)32-14-13-31(16-25-27-20-7-3-4-8-21(20)28-25)17-26-29-22-9-5-6-10-23(22)30-26/h3-12,15H,13-14,16-17H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | BVRTYZKBJWDLGZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |