C22H22O2 — CID 102526182
(1S,8R,9S,12R,14S)-9-phenyl-10,18-dioxapentacyclo[10.5.1.01,14.02,7.08,12]octadeca-2,4,6-triene (PubChem CID 102526182) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (1S,8R,9S,12R,14S)-9-phenyl-10,18-dioxapentacyclo[10.5.1.01,14.02,7.08,12]octadeca-2,4,6-triene.
| Compound Name | (1S,8R,9S,12R,14S)-9-phenyl-10,18-dioxapentacyclo[10.5.1.01,14.02,7.08,12]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 102526182 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (1S,8R,9S,12R,14S)-9-phenyl-10,18-dioxapentacyclo[10.5.1.01,14.02,7.08,12]octadeca-2,4,6-triene |
| SMILES | c1ccc([C@H]2OC[C@]34C[C@@H]5CCC[C@@]5(O3)c3ccccc3[C@H]24)cc1 |
| InChI | InChI=1S/C22H22O2/c1-2-7-15(8-3-1)20-19-17-10-4-5-11-18(17)22-12-6-9-16(22)13-21(19,24-22)14-23-20/h1-5,7-8,10-11,16,19-20H,6,9,12-14H2/t16-,19+,20+,21-,22-/m0/s1 |
| InChIKey | WPBJEYDKNFLERB-NKRQLCBBSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |