C23H18F6N2O3S — CID 102526282
5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine (PubChem CID 102526282) has the molecular formula C23H18F6N2O3S and a molecular weight of 516.46 g/mol. Its IUPAC name is 5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine.
| Compound Name | 5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine |
|---|---|
| PubChem CID | 102526282 |
| Molecular Formula | C23H18F6N2O3S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine |
| SMILES | COc1ccc(-c2cc(C3=C(c4cnc(OC)nc4OC)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C23H18F6N2O3S/c1-11-14(9-16(35-11)12-5-7-13(32-2)8-6-12)17-18(22(26,27)23(28,29)21(17,24)25)15-10-30-20(34-4)31-19(15)33-3/h5-10H,1-4H3 |
| InChIKey | MGBBPKZOAMBBKA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|