About naphtho[1,2-c]chromen-5-one
naphtho[1,2-c]chromen-5-one (PubChem CID 102526290) has the molecular formula C17H10O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is naphtho[1,2-c]chromen-5-one.
Molecular Properties
| Compound Name | naphtho[1,2-c]chromen-5-one |
| PubChem CID | 102526290 |
| Molecular Formula | C17H10O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | naphtho[1,2-c]chromen-5-one |
| SMILES | O=c1oc2ccccc2c2ccc3ccccc3c12 |
| InChI | InChI=1S/C17H10O2/c18-17-16-12-6-2-1-5-11(12)9-10-14(16)13-7-3-4-8-15(13)19-17/h1-10H |
| InChIKey | XMUDFWMLPCERRK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze naphtho[1,2-c]chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[1,2-c]chromen-5-one?
The IUPAC name of naphtho[1,2-c]chromen-5-one (CID 102526290) is naphtho[1,2-c]chromen-5-one.
What is the SMILES notation for naphtho[1,2-c]chromen-5-one?
The canonical SMILES for naphtho[1,2-c]chromen-5-one is O=c1oc2ccccc2c2ccc3ccccc3c12.
What is the InChIKey of naphtho[1,2-c]chromen-5-one?
The InChIKey is XMUDFWMLPCERRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O2/c18-17-16-12-6-2-1-5-11(12)9-10-14(16)13-7-3-4-8-15(13)19-17/h1-10H.
What are the key properties of naphtho[1,2-c]chromen-5-one?
naphtho[1,2-c]chromen-5-one has a molecular weight of 246.27 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[1,2-c]chromen-5-one is sourced from PubChem (CID 102526290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).