C17H10O2 — CID 102526290
naphtho[1,2-c]chromen-5-one (PubChem CID 102526290) has the molecular formula C17H10O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is naphtho[1,2-c]chromen-5-one.
| Compound Name | naphtho[1,2-c]chromen-5-one |
|---|---|
| PubChem CID | 102526290 |
| Molecular Formula | C17H10O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | naphtho[1,2-c]chromen-5-one |
| SMILES | O=c1oc2ccccc2c2ccc3ccccc3c12 |
| InChI | InChI=1S/C17H10O2/c18-17-16-12-6-2-1-5-11(12)9-10-14(16)13-7-3-4-8-15(13)19-17/h1-10H |
| InChIKey | XMUDFWMLPCERRK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|