C14H14F3NO — CID 102526334
1,1,1-trifluoro-2-(quinolin-2-ylmethyl)butan-2-ol (PubChem CID 102526334) has the molecular formula C14H14F3NO and a molecular weight of 269.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(quinolin-2-ylmethyl)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(quinolin-2-ylmethyl)butan-2-ol |
|---|---|
| PubChem CID | 102526334 |
| Molecular Formula | C14H14F3NO |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1,1,1-trifluoro-2-(quinolin-2-ylmethyl)butan-2-ol |
| SMILES | CCC(O)(Cc1ccc2ccccc2n1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO/c1-2-13(19,14(15,16)17)9-11-8-7-10-5-3-4-6-12(10)18-11/h3-8,19H,2,9H2,1H3 |
| InChIKey | MNHSDWIBPFPJLZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |