C18H13NO2S2 — CID 102526742
ethyl 2-phenylthieno[2,3-g][1,3]benzothiazole-7-carboxylate (PubChem CID 102526742) has the molecular formula C18H13NO2S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 2-phenylthieno[2,3-g][1,3]benzothiazole-7-carboxylate.
| Compound Name | ethyl 2-phenylthieno[2,3-g][1,3]benzothiazole-7-carboxylate |
|---|---|
| PubChem CID | 102526742 |
| Molecular Formula | C18H13NO2S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | ethyl 2-phenylthieno[2,3-g][1,3]benzothiazole-7-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccc3nc(-c4ccccc4)sc32)s1 |
| InChI | InChI=1S/C18H13NO2S2/c1-2-21-18(20)15-10-12-14(22-15)9-8-13-16(12)23-17(19-13)11-6-4-3-5-7-11/h3-10H,2H2,1H3 |
| InChIKey | CRNXHAIABGOUOK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |